CAS 898779-63-0

1-Propanone, 3-(3,4-dimethylphenyl)-1-[3-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(3,4-dimethylphenyl)-1-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3,4-dimethylphenyl group and a 3-trifluoromethylphenyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and interaction with biological systems. The compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and structure. Its chemical properties may include moderate to high stability under standard conditions, but it could be sensitive to strong oxidizing agents. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which could affect its solubility and behavior in various solvents. Overall, this compound may have applications in organic synthesis, pharmaceuticals, or materials science, although specific applications would depend on further research into its properties and reactivity.

Formula: C₁₈H₁₇F₃O

InChI: InChI=1/C18H17F3O/c1-12-6-7-14(10-13(12)2)8-9-17(22)15-4-3-5-16(11-15)18(19,20)21/h3-7,10-11H,8-9H2,1-2H3

InChI key: InChIKey=ONALJYLLGMZMRS-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=C(C)C=C1)(=O)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 3-(3,4-Dimethylphenyl)-3′-trifluoromethyl-propiophenone
• 1-Propanone, 3-(3,4-dimethylphenyl)-1-[3-(trifluoromethyl)phenyl]-