CAS 898779-64-1

5-Cyclohexyl-1-(2-pyridinyl)-1-pentanone

Description:

5-Cyclohexyl-1-(2-pyridinyl)-1-pentanone, with the CAS number 898779-64-1, is an organic compound characterized by its unique structure that includes a cyclohexyl group and a pyridine ring attached to a pentanone backbone. This compound typically exhibits properties common to ketones, such as being a polar molecule due to the carbonyl group, which can engage in hydrogen bonding. Its cyclohexyl substituent contributes to its hydrophobic characteristics, while the pyridine moiety may impart some basicity and potential for coordination with metal ions. The presence of both aliphatic and aromatic components suggests that it may have interesting solubility properties, potentially being soluble in organic solvents but less so in water. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis and reactivity can be influenced by the functional groups present, allowing for various chemical transformations. Overall, 5-Cyclohexyl-1-(2-pyridinyl)-1-pentanone represents a versatile structure in organic chemistry with potential applications in various fields.

Formula: C₁₆H₂₃NO

InChI: InChI=1S/C16H23NO/c18-16(15-11-6-7-13-17-15)12-5-4-10-14-8-2-1-3-9-14/h6-7,11,13-14H,1-5,8-10,12H2

InChI key: InChIKey=ZPPNNIFZKKXNHS-UHFFFAOYSA-N

SMILES: C(CCCCC1CCCCC1)(=O)C2=CC=CC=N2

Synonyms:

• 5-Cyclohexyl-1-(2-pyridinyl)-1-pentanone
• 1-Pentanone, 5-cyclohexyl-1-(2-pyridinyl)-