CAS 898779-65-2

1-Propanone, 3-(3,4-dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(3,4-dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3,4-dimethylphenyl group and a 4-trifluoromethylphenyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and interaction with biological systems. The dimethyl substitution on the phenyl ring contributes to steric hindrance, potentially affecting the compound's physical properties such as boiling point and solubility. Generally, compounds of this type may exhibit interesting chemical behavior, including potential applications in pharmaceuticals or materials science due to their unique structural features. Additionally, the presence of fluorine atoms often imparts unique electronic properties, making such compounds valuable in various chemical syntheses and applications. Safety and handling considerations should be taken into account, as with many organic compounds, particularly those containing halogens.

Formula: C₁₈H₁₇F₃O

InChI: InChI=1S/C18H17F3O/c1-12-3-4-14(11-13(12)2)5-10-17(22)15-6-8-16(9-7-15)18(19,20)21/h3-4,6-9,11H,5,10H2,1-2H3

InChI key: InChIKey=USNDIDTUCZKXRV-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC=C(C(CCC2=CC(C)=C(C)C=C2)=O)C=C1

Synonyms:

• 3-(3,4-Dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]-1-propanone
• 3-(3,4-Dimethylphenyl)-4′-trifluoromethyl-propiophenone
• 1-Propanone, 3-(3,4-dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]-

3-(3,4-dimethylphenyl)-4′-trifluoromethylpropiophenone

CAS: 898779-65-2

Formula: C₁₈H₁₇F₃O

Purity: 97.0%

Molecular weight: 306.328

Ref: 10-F206605