CAS 898779-74-3
:3,5,5-trimethyl-1-(2-pyridyl)hexan-1-one
Description:
3,5,5-Trimethyl-1-(2-pyridyl)hexan-1-one, with the CAS number 898779-74-3, is an organic compound characterized by its ketone functional group and a complex aliphatic structure. It features a hexane backbone with three methyl groups at the 3 and 5 positions, contributing to its branched nature, and a pyridine ring substituent at the 1-position. This compound is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its molecular structure suggests potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of the pyridine moiety may impart specific reactivity and interaction properties, making it of interest in medicinal chemistry and materials science. Additionally, the compound's stability and reactivity can be influenced by the steric hindrance introduced by the trimethyl groups, which may affect its behavior in chemical reactions. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C14H21NO
InChI:InChI=1/C14H21NO/c1-11(10-14(2,3)4)9-13(16)12-7-5-6-8-15-12/h5-8,11H,9-10H2,1-4H3
SMILES:CC(CC(=O)c1ccccn1)CC(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.