CymitQuimica logo

CAS 898779-76-5

:

2-pyridyl-[2-(trifluoromethyl)phenyl]methanone

Description:
2-Pyridyl-[2-(trifluoromethyl)phenyl]methanone, identified by its CAS number 898779-76-5, is an organic compound characterized by its complex structure, which includes a pyridine ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The compound may also display significant polar characteristics due to the electronegative fluorine atoms, which can affect its solubility in various solvents. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the functional groups present. Overall, 2-pyridyl-[2-(trifluoromethyl)phenyl]methanone is a versatile compound with potential applications in pharmaceuticals and agrochemicals, warranting further investigation into its properties and reactivity.
Formula:C13H8F3NO
InChI:InChI=1/C13H8F3NO/c14-13(15,16)10-6-2-1-5-9(10)12(18)11-7-3-4-8-17-11/h1-8H
SMILES:c1ccc(c(c1)C(=O)c1ccccn1)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.