CAS 898779-83-4

1-Propanone, 1-(3,5-dichlorophenyl)-3-(3,4-dimethylphenyl)-

Description:

1-Propanone, 1-(3,5-dichlorophenyl)-3-(3,4-dimethylphenyl)-, also known by its CAS number 898779-83-4, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3,5-dichlorophenyl group and a 3,4-dimethylphenyl group. The presence of chlorine atoms in the aromatic ring contributes to its chemical reactivity and potential biological activity. The dimethyl substitution on the second aromatic ring enhances its steric properties. This compound is likely to exhibit moderate polarity due to the ketone group, influencing its solubility in various organic solvents. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which may affect its behavior in biological systems or materials science applications. Overall, this compound's unique structure may render it of interest in fields such as medicinal chemistry or materials development, although specific applications would depend on further research into its properties and interactions.

Formula: C₁₇H₁₆Cl₂O

InChI: InChI=1S/C17H16Cl2O/c1-11-3-4-13(7-12(11)2)5-6-17(20)14-8-15(18)10-16(19)9-14/h3-4,7-10H,5-6H2,1-2H3

InChI key: InChIKey=ZYSDOVARQCSAER-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=C(C)C=C1)(=O)C2=CC(Cl)=CC(Cl)=C2

Synonyms:

• 1-(3,5-Dichlorophenyl)-3-(3,4-dimethylphenyl)-1-propanone
• 1-Propanone, 1-(3,5-dichlorophenyl)-3-(3,4-dimethylphenyl)-
• 3′,5′-Dichloro-3-(3,4-dimethylphenyl)propiophenone

3′,5′-dichloro-3-(3,4-dimethylphenyl)propiophenone

CAS: 898779-83-4

Formula: C₁₇H₁₆Cl₂O

Purity: 97.0%

Molecular weight: 307.21

Ref: 10-F206614