CAS 898779-87-8
:1-(3,4-difluorophenyl)-3-(3,4-dimethylphenyl)propan-1-one
Description:
1-(3,4-Difluorophenyl)-3-(3,4-dimethylphenyl)propan-1-one, with the CAS number 898779-87-8, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone, where the carbonyl group is flanked by two aromatic rings: one containing two fluorine substituents and the other containing two methyl groups. The presence of the difluorophenyl group contributes to its unique electronic properties, potentially enhancing its reactivity and influencing its interactions in various chemical environments. The dimethylphenyl group adds steric bulk, which can affect the compound's solubility and overall stability. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity and environmental impact.
Formula:C17H16F2O
InChI:InChI=1/C17H16F2O/c1-11-3-4-13(9-12(11)2)5-8-17(20)14-6-7-15(18)16(19)10-14/h3-4,6-7,9-10H,5,8H2,1-2H3
SMILES:Cc1ccc(CCC(=O)c2ccc(c(c2)F)F)cc1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.