CAS 898780-04-6
:1-Propanone, 1-(3,5-dimethylphenyl)-3-[2-(methylthio)phenyl]-
Description:
1-Propanone, 1-(3,5-dimethylphenyl)-3-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3,5-dimethylphenyl group and a 2-(methylthio)phenyl group. The presence of the methylthio group introduces a sulfur atom into the molecular structure, which can influence the compound's reactivity and solubility. The aromatic rings contribute to the compound's stability and can affect its electronic properties. Typically, compounds of this nature may exhibit moderate to low solubility in water but are often soluble in organic solvents. The presence of multiple functional groups suggests potential applications in organic synthesis or as intermediates in the production of more complex molecules. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C18H20OS
InChI:InChI=1S/C18H20OS/c1-13-10-14(2)12-16(11-13)17(19)9-8-15-6-4-5-7-18(15)20-3/h4-7,10-12H,8-9H2,1-3H3
InChI key:InChIKey=IZQOLXRZPXFIBK-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(C)=CC(C)=C1)C2=C(SC)C=CC=C2
Synonyms:- 1-(3,5-Dimethylphenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone
- 1-Propanone, 1-(3,5-dimethylphenyl)-3-[2-(methylthio)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.