CymitQuimica logo

CAS 898780-05-7

:

3-(3,5-dimethylphenyl)-1-(o-tolyl)propan-1-one

Description:
3-(3,5-Dimethylphenyl)-1-(o-tolyl)propan-1-one, identified by its CAS number 898780-05-7, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two aromatic groups: a 3,5-dimethylphenyl group and an o-tolyl group. This compound is characterized by its relatively complex structure, which contributes to its unique chemical properties. It typically exhibits a moderate to high melting point and boiling point, indicative of its molecular weight and the presence of aromatic rings that enhance stability. The presence of multiple methyl groups in the structure can influence its reactivity and solubility, often making it more lipophilic. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Its applications can span across fields such as organic synthesis, pharmaceuticals, and materials science, although specific uses may vary based on its reactivity and functional properties. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C18H20O
InChI:InChI=1/C18H20O/c1-13-10-14(2)12-16(11-13)8-9-18(19)17-7-5-4-6-15(17)3/h4-7,10-12H,8-9H2,1-3H3
SMILES:Cc1cc(C)cc(CCC(=O)c2ccccc2C)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.