CAS 898780-07-9

1-(4-bromo-3-fluoro-phenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:

1-(4-bromo-3-fluoro-phenyl)-3-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898780-07-9, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with a bromo and a fluoro group on one phenyl ring and a methylsulfanyl group on another. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions. The presence of halogen substituents (bromo and fluoro) can influence its reactivity, making it a candidate for various chemical transformations. Additionally, the methylsulfanyl group may impart unique electronic and steric effects, affecting the compound's overall reactivity and interaction with biological systems. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in diverse chemical reactions. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from chemical databases for practical applications.

Formula: C₁₆H₁₄BrFOS

InChI: InChI=1/C16H14BrFOS/c1-20-16-5-3-2-4-11(16)7-9-15(19)12-6-8-13(17)14(18)10-12/h2-6,8,10H,7,9H2,1H3

SMILES: CSc1ccccc1CCC(=O)c1ccc(c(c1)F)Br