CAS 898780-09-1

[4-(Hexyloxy)phenyl]-2-pyridinylmethanone

Description:

[4-(Hexyloxy)phenyl]-2-pyridinylmethanone, with the CAS number 898780-09-1, is an organic compound characterized by its complex structure that includes a phenyl ring substituted with a hexyloxy group and a pyridinylmethanone moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The hexyloxy group enhances its solubility in organic solvents, making it suitable for applications in organic synthesis and materials science. Additionally, the presence of the pyridine ring may impart unique electronic properties, influencing its reactivity and interactions with other molecules. This compound may also exhibit biological activity, which could be of interest in pharmaceutical research. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature review for precise values. Overall, [4-(Hexyloxy)phenyl]-2-pyridinylmethanone represents a versatile structure with potential applications in various fields of chemistry and material science.

Formula: C₁₈H₂₁NO₂

InChI: InChI=1/C18H21NO2/c1-2-3-4-7-14-21-16-11-9-15(10-12-16)18(20)17-8-5-6-13-19-17/h5-6,8-13H,2-4,7,14H2,1H3

InChI key: InChIKey=DEMGCNJPUWSSAP-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OCCCCCC)C=C1)C2=CC=CC=N2

Synonyms:

• Methanone, [4-(hexyloxy)phenyl]-2-pyridinyl-
• [4-(Hexyloxy)phenyl]-2-pyridinylmethanone

2-(4-Hexyloxybenzoyl)pyridine

CAS: 898780-09-1

Formula: C₁₈H₂₁NO₂

Purity: 97.0%

Molecular weight: 283.371

Ref: 10-F202561