CAS 898780-10-4
:1-Propanone, 1-(4-chloro-3-fluorophenyl)-3-[2-(methylthio)phenyl]-
Description:
1-Propanone, 1-(4-chloro-3-fluorophenyl)-3-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with substituents that include a 4-chloro-3-fluorophenyl group and a 2-(methylthio)phenyl group, contributing to its unique chemical properties. The presence of halogen atoms, such as chlorine and fluorine, typically enhances the compound's reactivity and can influence its solubility and boiling point. The methylthio group may also affect the compound's electronic properties and steric hindrance. As a ketone, it is likely to participate in nucleophilic addition reactions and can serve as a precursor in various synthetic pathways. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the nature of its substituents. Overall, this compound is of interest in organic synthesis and may have applications in pharmaceuticals or materials science.
Formula:C16H14ClFOS
InChI:InChI=1/C16H14ClFOS/c1-20-16-5-3-2-4-11(16)7-9-15(19)12-6-8-13(17)14(18)10-12/h2-6,8,10H,7,9H2,1H3
InChI key:InChIKey=COUHPMUSXMTNJS-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(F)=C(Cl)C=C1)C2=C(SC)C=CC=C2
Synonyms:- 1-(4-Chloro-3-fluorophenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone
- 1-Propanone, 1-(4-chloro-3-fluorophenyl)-3-[2-(methylthio)phenyl]-
- 4'-CHLORO-3'-FLUORO-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.