CAS 898780-15-9
:(2,3-difluorophenyl)-(2-pyridyl)methanone
Description:
(2,3-Difluorophenyl)-(2-pyridyl)methanone is an organic compound characterized by its unique structure, which includes a difluorophenyl group and a pyridyl moiety attached to a carbonyl functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential for π-π stacking interactions due to its aromatic rings. The presence of fluorine atoms can influence its reactivity and polarity, often enhancing lipophilicity and altering the compound's electronic properties. As a ketone, it features a carbonyl group that can participate in various chemical reactions, such as nucleophilic addition. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions. Overall, (2,3-difluorophenyl)-(2-pyridyl)methanone represents a versatile structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C12H7F2NO
InChI:InChI=1/C12H7F2NO/c13-9-5-3-4-8(11(9)14)12(16)10-6-1-2-7-15-10/h1-7H
SMILES:c1ccnc(c1)C(=O)c1cccc(c1F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.