CymitQuimica logo

CAS 898780-16-0

:

1-(2-chlorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:
1-(2-Chlorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898780-16-0, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two aromatic substituents: a 2-chlorophenyl group and a 2-methylsulfanylphenyl group. The presence of the chlorine atom introduces a degree of electronegativity, potentially influencing the compound's reactivity and solubility. The methylsulfanyl group contributes to the compound's overall hydrophobic character while also providing potential sites for further chemical modifications. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in various fields, including pharmaceuticals and agrochemicals. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with many organic compounds, safety data and handling precautions should be considered due to potential toxicity or reactivity.
Formula:C16H15ClOS
InChI:InChI=1/C16H15ClOS/c1-19-16-9-5-2-6-12(16)10-11-15(18)13-7-3-4-8-14(13)17/h2-9H,10-11H2,1H3
SMILES:CSc1ccccc1CCC(=O)c1ccccc1Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.