CAS 898780-17-1
:1-Propanone, 3-(3,5-dimethylphenyl)-1-(3-methoxyphenyl)-
Description:
1-Propanone, 3-(3,5-dimethylphenyl)-1-(3-methoxyphenyl)-, also known by its CAS number 898780-17-1, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic substituents: a 3,5-dimethylphenyl group and a 3-methoxyphenyl group. The presence of these substituents contributes to its unique chemical properties, including potential variations in reactivity and solubility. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the aromatic rings, which can influence their behavior in biological systems and their interactions with other molecules. The methoxy group can also enhance the compound's electron-donating properties, potentially affecting its reactivity in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit interesting optical properties, making it of interest in various applications, including pharmaceuticals and materials science. However, specific physical properties such as boiling point, melting point, and solubility would need to be referenced from experimental data or literature for precise applications.
Formula:C18H20O2
InChI:InChI=1/C18H20O2/c1-13-9-14(2)11-15(10-13)7-8-18(19)16-5-4-6-17(12-16)20-3/h4-6,9-12H,7-8H2,1-3H3
InChI key:InChIKey=ZUVWKNSDXWXYSE-UHFFFAOYSA-N
SMILES:C(CCC1=CC(C)=CC(C)=C1)(=O)C2=CC(OC)=CC=C2
Synonyms:- 3-(3,5-Dimethylphenyl)-3′-methoxypropiophenone
- 3-(3,5-Dimethylphenyl)-1-(3-methoxyphenyl)-1-propanone
- 1-Propanone, 3-(3,5-dimethylphenyl)-1-(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.