CAS 898780-19-3

1-(2-fluorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:

1-(2-Fluorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898780-19-3, is an organic compound characterized by its ketone functional group and the presence of both fluorine and sulfur substituents on its aromatic rings. This compound features a propanone backbone, which contributes to its reactivity and potential applications in organic synthesis. The fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity, while the methylthio group can affect its electronic properties and steric hindrance. The presence of two distinct phenyl groups allows for various interactions, making it of interest in medicinal chemistry and material science. Its structural complexity suggests potential utility in the development of pharmaceuticals or agrochemicals, where modifications to the aromatic rings can lead to diverse biological activities. As with many organic compounds, its physical properties, such as solubility and melting point, would depend on the specific molecular interactions and the overall molecular structure. Safety and handling precautions should be observed due to its chemical nature.

Formula: C₁₆H₁₅FOS

InChI: InChI=1/C16H15FOS/c1-19-16-9-5-2-6-12(16)10-11-15(18)13-7-3-4-8-14(13)17/h2-9H,10-11H2,1H3

SMILES: CSc1ccccc1CCC(=O)c1ccccc1F

Synonyms:

• 2'-FLUORO-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE
• 1-(2-fluorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one