CymitQuimica logo

CAS 898780-22-8

:

3-(2-methylsulfanylphenyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one

Description:
3-(2-Methylsulfanylphenyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one, with the CAS number 898780-22-8, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a methylsulfanyl group and a trifluoromethyl group. The presence of the methylsulfanyl group contributes to its potential as a nucleophile in various chemical reactions, while the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the functional groups present. It may also show interesting properties in terms of solubility, depending on the solvent used, due to the contrasting polarities of the substituents. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or materials science, where the unique combination of functional groups can lead to novel properties or activities.
Formula:C17H15F3OS
InChI:InChI=1/C17H15F3OS/c1-22-16-9-5-2-6-12(16)10-11-15(21)13-7-3-4-8-14(13)17(18,19)20/h2-9H,10-11H2,1H3
SMILES:CSc1ccccc1CCC(=O)c1ccccc1C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.