CAS 898780-25-1

1-Propanone, 3-[2-(methylthio)phenyl]-1-[3-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-[2-(methylthio)phenyl]-1-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a methylthio group attached to a phenyl ring and a trifluoromethyl group on another phenyl ring. The presence of the methylthio group introduces sulfur into the molecular structure, which can influence its reactivity and solubility. The trifluoromethyl group is known for its electron-withdrawing properties, which can affect the compound's electronic characteristics and stability. This compound is likely to be a solid or liquid at room temperature, depending on its molecular interactions and structure. Its unique combination of functional groups may impart specific chemical properties, making it of interest in various fields, including pharmaceuticals and materials science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₁₅F₃OS

InChI: InChI=1S/C17H15F3OS/c1-22-16-8-3-2-5-12(16)9-10-15(21)13-6-4-7-14(11-13)17(18,19)20/h2-8,11H,9-10H2,1H3

InChI key: InChIKey=PIYWJXSTBORTHC-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC(C(F)(F)F)=CC=C1)C2=C(SC)C=CC=C2

Synonyms:

• 1-Propanone, 3-[2-(methylthio)phenyl]-1-[3-(trifluoromethyl)phenyl]-
• 3-[2-(Methylsulfanyl)phenyl]-1-[3-(trifluoromethyl)phenyl]-1-propanone