CymitQuimica logo

CAS 898780-27-3

:

(3,4-Difluorophenyl)-2-pyridinylmethanone

Description:
(3,4-Difluorophenyl)-2-pyridinylmethanone, with the CAS number 898780-27-3, is a chemical compound characterized by its unique structure, which includes a pyridine ring and a difluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The difluorophenyl moiety can influence its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The presence of fluorine atoms often enhances lipophilicity and metabolic stability, which can be advantageous in drug design. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR, mass spectrometry, and IR spectroscopy to confirm its structure and purity. Overall, (3,4-Difluorophenyl)-2-pyridinylmethanone represents a versatile scaffold for further chemical exploration and application.
Formula:C12H7F2NO
InChI:InChI=1S/C12H7F2NO/c13-9-5-4-8(7-10(9)14)12(16)11-3-1-2-6-15-11/h1-7H
InChI key:InChIKey=MKGAISLAGNOFSW-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(F)C=C1)C2=CC=CC=N2
Synonyms:
  • (3,4-Difluorophenyl)(pyridin-2-yl)methanone
  • (3,4-Difluorophenyl)-2-pyridinylmethanone
  • 2-(3,4-Difluorobenzoyl)pyridine
  • Methanone, (3,4-Difluorophenyl)-2-Pyridinyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.