CAS 898780-28-4
:1-Propanone, 3-[2-(methylthio)phenyl]-1-[4-(trifluoromethyl)phenyl]-
Description:
1-Propanone, 3-[2-(methylthio)phenyl]-1-[4-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a methylthio group attached to a phenyl ring and a trifluoromethyl group attached to another phenyl ring. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and interaction with biological systems. The methylthio group may contribute to the compound's overall electronic properties and steric effects. As a ketone, it is expected to exhibit typical reactivity associated with carbonyl compounds, including nucleophilic addition reactions. The compound's unique structure suggests potential applications in pharmaceuticals or agrochemicals, where the specific functional groups can impart desirable properties. However, detailed studies would be necessary to fully understand its behavior, stability, and potential uses in various chemical contexts.
Formula:C17H15F3OS
InChI:InChI=1S/C17H15F3OS/c1-22-16-5-3-2-4-13(16)8-11-15(21)12-6-9-14(10-7-12)17(18,19)20/h2-7,9-10H,8,11H2,1H3
InChI key:InChIKey=WKKKXZARIBHLNL-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=C(C(F)(F)F)C=C1)C2=C(SC)C=CC=C2
Synonyms:- 1-Propanone, 3-[2-(methylthio)phenyl]-1-[4-(trifluoromethyl)phenyl]-
- 3-[2-(Methylsulfanyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.