CAS 898780-33-1

(2,5-Dichlorophenyl)-2-pyridinylmethanone

Description:

(2,5-Dichlorophenyl)-2-pyridinylmethanone, with the CAS number 898780-33-1, is a chemical compound characterized by its unique structural features, which include a dichlorophenyl group and a pyridinylmethanone moiety. This compound typically exhibits a solid state at room temperature and is known for its potential applications in medicinal chemistry and as an intermediate in organic synthesis. The presence of chlorine atoms in the phenyl ring enhances its reactivity and may influence its biological activity. The pyridine ring contributes to the compound's aromaticity and can participate in various chemical interactions, making it a versatile building block in the development of pharmaceuticals. Additionally, the compound's properties, such as solubility, melting point, and stability, can vary based on the specific conditions and solvents used. Safety data should be consulted to understand its handling and potential hazards, as compounds with halogen substituents can exhibit toxicity or environmental concerns. Overall, (2,5-Dichlorophenyl)-2-pyridinylmethanone represents a significant structure in the field of organic chemistry.

Formula: C₁₂H₇Cl₂NO

InChI: InChI=1S/C12H7Cl2NO/c13-8-4-5-10(14)9(7-8)12(16)11-3-1-2-6-15-11/h1-7H

InChI key: InChIKey=VYFYNXRADGDHPE-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=CC(Cl)=C1)C2=CC=CC=N2

Synonyms:

• (2,5-Dichlorophenyl)-2-pyridinylmethanone
• Methanone, (2,5-dichlorophenyl)-2-pyridinyl-