CAS 898780-34-2
:1-(2-Chloro-4-fluorophenyl)-3-[2-(methylthio)phenyl]-1-propanone
Description:
1-(2-Chloro-4-fluorophenyl)-3-[2-(methylthio)phenyl]-1-propanone, with the CAS number 898780-34-2, is an organic compound characterized by its complex structure, which includes a propanone moiety and two aromatic rings. The presence of a chloro and a fluoro substituent on one phenyl ring contributes to its potential reactivity and lipophilicity, while the methylthio group on the second phenyl ring can influence its electronic properties and steric hindrance. This compound is likely to exhibit properties typical of ketones, such as being a polar solvent with potential applications in organic synthesis or medicinal chemistry. Its unique substituents may also impart specific biological activities, making it of interest in pharmaceutical research. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H14ClFOS
InChI:InChI=1S/C16H14ClFOS/c1-20-16-5-3-2-4-11(16)6-9-15(19)13-8-7-12(18)10-14(13)17/h2-5,7-8,10H,6,9H2,1H3
InChI key:InChIKey=GEYFMTYBIYTGPG-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=C(Cl)C=C(F)C=C1)C2=C(SC)C=CC=C2
Synonyms:- 1-(2-Chloro-4-fluorophenyl)-3-[2-(methylthio)phenyl]-1-propanone
- 1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-[2-(methylthio)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.