CAS 898780-37-5

1-(3-chloro-5-fluoro-phenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:

1-(3-Chloro-5-fluoro-phenyl)-3-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898780-37-5, is an organic compound characterized by its complex structure that includes a propanone backbone substituted with a chloro and a fluoro group on one phenyl ring, and a methylsulfanyl group on another phenyl ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of halogen substituents, which can influence its chemical behavior in various reactions. The presence of the methylsulfanyl group may also impart unique electronic and steric effects, affecting its interactions in biological systems or synthetic pathways. As a ketone, it may participate in nucleophilic addition reactions and can serve as a precursor in the synthesis of more complex molecules. Its specific applications and biological activity would depend on further studies, particularly in medicinal chemistry or material science contexts.

Formula: C₁₆H₁₄ClFOS

InChI: InChI=1/C16H14ClFOS/c1-20-16-5-3-2-4-11(16)6-7-15(19)12-8-13(17)10-14(18)9-12/h2-5,8-10H,6-7H2,1H3

SMILES: CSc1ccccc1CCC(=O)c1cc(cc(c1)F)Cl