CymitQuimica logo

CAS 898780-40-0

:

1-(4-chloro-2-fluoro-phenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:
1-(4-chloro-2-fluoro-phenyl)-3-(2-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898780-40-0, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a phenyl group substituted with both a chlorine and a fluorine atom, which can influence its reactivity and biological activity. Additionally, it has a second phenyl group that is substituted with a methylthio group, which can enhance its lipophilicity and potentially affect its interaction with biological targets. The presence of halogen atoms often contributes to the compound's pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds with specific biological activities. As with many organic compounds, its physical properties, such as solubility and melting point, would depend on the specific interactions between its functional groups and the surrounding environment. Safety and handling precautions should be observed due to the presence of halogens and sulfur in its structure.
Formula:C16H14ClFOS
InChI:InChI=1/C16H14ClFOS/c1-20-16-5-3-2-4-11(16)6-9-15(19)13-8-7-12(17)10-14(13)18/h2-5,7-8,10H,6,9H2,1H3
SMILES:CSc1ccccc1CCC(=O)c1ccc(cc1F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.