CAS 898780-43-3
:1-Propanone, 1-(2,3-dichlorophenyl)-3-[2-(methylthio)phenyl]-
Description:
1-Propanone, 1-(2,3-dichlorophenyl)-3-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with substituents that include a dichlorophenyl group and a methylthio-phenyl group, contributing to its unique chemical properties. The presence of chlorine atoms in the dichlorophenyl moiety enhances the compound's reactivity and may influence its biological activity. The methylthio group can also affect the compound's solubility and interaction with other molecules. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit specific physical properties such as boiling and melting points, which are influenced by the steric and electronic effects of the substituents. Overall, this compound represents a complex organic molecule with potential utility in various chemical applications.
Formula:C16H14Cl2OS
InChI:InChI=1S/C16H14Cl2OS/c1-20-15-8-3-2-5-11(15)9-10-14(19)12-6-4-7-13(17)16(12)18/h2-8H,9-10H2,1H3
InChI key:InChIKey=CGTGGYKWWICLQU-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=C(Cl)C(Cl)=CC=C1)C2=C(SC)C=CC=C2
Synonyms:- 1-(2,3-Dichlorophenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone
- 1-Propanone, 1-(2,3-dichlorophenyl)-3-[2-(methylthio)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.