CymitQuimica logo

CAS 898780-46-6

:

1-(2,4-dichlorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:
1-(2,4-Dichlorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898780-46-6, is an organic compound characterized by its complex structure featuring a propanone backbone substituted with a dichlorophenyl group and a methylsulfanylphenyl group. This compound typically exhibits properties associated with ketones, including a carbonyl functional group that contributes to its reactivity and potential applications in organic synthesis. The presence of the dichlorophenyl moiety may impart significant biological activity, while the methylsulfanyl group can influence its solubility and interaction with other molecules. The compound is likely to be a solid at room temperature, with potential uses in pharmaceuticals or as an intermediate in chemical synthesis. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods or detailed literature review. Safety data should also be consulted, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C16H14Cl2OS
InChI:InChI=1/C16H14Cl2OS/c1-20-16-5-3-2-4-11(16)6-9-15(19)13-8-7-12(17)10-14(13)18/h2-5,7-8,10H,6,9H2,1H3
SMILES:CSc1ccccc1CCC(=O)c1ccc(cc1Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.