CAS 898780-49-9
:1-Propanone, 1-(2,5-dichlorophenyl)-3-[2-(methylthio)phenyl]-
Description:
1-Propanone, 1-(2,5-dichlorophenyl)-3-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a methylthio-substituted phenyl group. The presence of chlorine atoms on the phenyl ring contributes to its chemical reactivity and potential biological activity, while the methylthio group can influence its solubility and interaction with other molecules. Typically, compounds of this nature may exhibit properties such as moderate volatility and varying degrees of polarity, depending on the substituents. They may also show potential applications in pharmaceuticals or agrochemicals due to their structural complexity. Safety data would indicate that handling should be done with care, as many organic compounds can be hazardous. Overall, the specific characteristics of this compound would depend on its molecular interactions and the environment in which it is used.
Formula:C16H14Cl2OS
InChI:InChI=1S/C16H14Cl2OS/c1-20-16-5-3-2-4-11(16)6-9-15(19)13-10-12(17)7-8-14(13)18/h2-5,7-8,10H,6,9H2,1H3
InChI key:InChIKey=QNQWZBJPURGBKZ-UHFFFAOYSA-N
SMILES:C(CCC1=C(SC)C=CC=C1)(=O)C2=C(Cl)C=CC(Cl)=C2
Synonyms:- 1-Propanone, 1-(2,5-dichlorophenyl)-3-[2-(methylthio)phenyl]-
- 1-(2,5-Dichlorophenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.