CAS 898780-52-4
:1-Propanone, 1-(3,4-dichlorophenyl)-3-[2-(methylthio)phenyl]-
Description:
1-Propanone, 1-(3,4-dichlorophenyl)-3-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with a dichlorophenyl group and a methylthio-substituted phenyl group, contributing to its unique chemical properties. The presence of chlorine atoms enhances its reactivity and may influence its biological activity, while the methylthio group can affect its solubility and interaction with other molecules. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit interesting electronic properties due to the presence of multiple aromatic rings and substituents, which can affect its stability and reactivity. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would be influenced by its molecular weight and the nature of its substituents. Overall, this compound represents a complex structure with potential implications in various chemical and biological contexts.
Formula:C16H14Cl2OS
InChI:InChI=1S/C16H14Cl2OS/c1-20-16-5-3-2-4-11(16)7-9-15(19)12-6-8-13(17)14(18)10-12/h2-6,8,10H,7,9H2,1H3
InChI key:InChIKey=LKAYGMMXRDTBPX-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(Cl)=C(Cl)C=C1)C2=C(SC)C=CC=C2
Synonyms:- 1-Propanone, 1-(3,4-dichlorophenyl)-3-[2-(methylthio)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.