CAS 898780-55-7
:1-(3,5-dichlorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one
Description:
1-(3,5-Dichlorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898780-55-7, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with a dichlorophenyl group and a methylsulfanylphenyl group. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It may possess moderate to high lipophilicity due to the presence of aromatic rings and halogen substituents, which can influence its solubility in organic solvents. The dichlorophenyl moiety may impart biological activity, making it of interest in pharmaceutical research. Additionally, the methylsulfanyl group can enhance the compound's reactivity and potential interactions in various chemical environments. Safety data should be consulted for handling, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and materials science.
Formula:C16H14Cl2OS
InChI:InChI=1/C16H14Cl2OS/c1-20-16-5-3-2-4-11(16)6-7-15(19)12-8-13(17)10-14(18)9-12/h2-5,8-10H,6-7H2,1H3
SMILES:CSc1ccccc1CCC(=O)c1cc(cc(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.