CAS 898780-56-8

1-Propanone, 1-(4-chlorophenyl)-3-(3,5-dimethylphenyl)-

Description:

1-Propanone, 1-(4-chlorophenyl)-3-(3,5-dimethylphenyl)-, also known by its CAS number 898780-56-8, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 4-chlorophenyl group and a 3,5-dimethylphenyl group. The presence of the chlorine atom and the methyl groups on the phenyl rings contributes to its unique chemical properties, including potential variations in reactivity and solubility. Typically, compounds of this nature exhibit moderate polarity due to the ketone functional group, which can influence their interactions with other molecules. Additionally, the aromatic rings may impart stability and influence the compound's behavior in various chemical reactions. This compound may be of interest in fields such as organic synthesis, pharmaceuticals, or materials science, where its specific structural features could be leveraged for various applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₇H₁₇ClO

InChI: InChI=1S/C17H17ClO/c1-12-9-13(2)11-14(10-12)3-8-17(19)15-4-6-16(18)7-5-15/h4-7,9-11H,3,8H2,1-2H3

InChI key: InChIKey=OVCYONKMUSSWNF-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=CC(C)=C1)(=O)C2=CC=C(Cl)C=C2

Synonyms:

• 1-(4-Chlorophenyl)-3-(3,5-dimethylphenyl)-1-propanone
• 4′-Chloro-3-(3,5-dimethylphenyl)propiophenone
• 1-Propanone, 1-(4-chlorophenyl)-3-(3,5-dimethylphenyl)-