CAS 898780-57-9

1-Propanone, 1-(2,4-difluorophenyl)-3-[2-(methylthio)phenyl]-

Description:

1-Propanone, 1-(2,4-difluorophenyl)-3-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2,4-difluorophenyl group and a 2-(methylthio)phenyl group. The presence of fluorine atoms in the aromatic ring can influence the compound's reactivity and physical properties, such as polarity and boiling point. The methylthio group introduces a sulfur atom, which can affect the compound's electronic properties and potential interactions in chemical reactions. Generally, compounds like this may exhibit moderate to high lipophilicity due to their aromatic nature, which can influence their solubility in organic solvents. Additionally, the presence of multiple functional groups suggests potential applications in pharmaceuticals or materials science, where such compounds may serve as intermediates or active ingredients. Safety and handling considerations should be taken into account, as with many organic compounds, particularly those containing halogens and sulfur.

Formula: C₁₆H₁₄F₂OS

InChI: InChI=1S/C16H14F2OS/c1-20-16-5-3-2-4-11(16)6-9-15(19)13-8-7-12(17)10-14(13)18/h2-5,7-8,10H,6,9H2,1H3

InChI key: InChIKey=SNRUIZVLOOQXME-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(F)C=C(F)C=C1)C2=C(SC)C=CC=C2

Synonyms:

• 1-Propanone, 1-(2,4-difluorophenyl)-3-[2-(methylthio)phenyl]-
• 1-(2,4-Difluorophenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone