CAS 898780-59-1
:1-Propanone, 1-(3,4-difluorophenyl)-3-[2-(methylthio)phenyl]-
Description:
1-Propanone, 1-(3,4-difluorophenyl)-3-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with a 3,4-difluorophenyl group and a 2-(methylthio)phenyl substituent, contributing to its unique chemical properties. The presence of fluorine atoms enhances its reactivity and can influence its physical properties, such as boiling point and solubility. The methylthio group introduces a sulfur atom, which can affect the compound's electronic characteristics and potential interactions with biological systems. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit interesting biological activity, although specific biological properties would require empirical investigation. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with multiple functional groups and substituents.
Formula:C16H14F2OS
InChI:InChI=1/C16H14F2OS/c1-20-16-5-3-2-4-11(16)7-9-15(19)12-6-8-13(17)14(18)10-12/h2-6,8,10H,7,9H2,1H3
InChI key:InChIKey=XMMYTIBMCUYCPM-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(F)=C(F)C=C1)C2=C(SC)C=CC=C2
Synonyms:- 1-Propanone, 1-(3,4-difluorophenyl)-3-[2-(methylthio)phenyl]-
- 1-(3,4-Difluorophenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone
- 1-(3,4-difluorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one
- 3',4'-DIFLUORO-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.