CAS 898780-61-5

1-(3,5-difluorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:

1-(3,5-Difluorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898780-61-5, is an organic compound characterized by its ketone functional group and the presence of multiple aromatic rings. This compound features a propanone backbone, where the carbonyl group is flanked by two distinct aromatic substituents: a 3,5-difluorophenyl group and a 2-methylsulfanylphenyl group. The difluorination introduces electron-withdrawing fluorine atoms, which can influence the compound's reactivity and stability. The methylsulfanyl group adds a sulfur atom, which can enhance the compound's nucleophilicity and may affect its solubility and interaction with biological systems. The overall structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound's unique characteristics may contribute to its biological activity, making it a subject of interest for further research in drug discovery and development.

Formula: C₁₆H₁₄F₂OS

InChI: InChI=1/C16H14F2OS/c1-20-16-5-3-2-4-11(16)6-7-15(19)12-8-13(17)10-14(18)9-12/h2-5,8-10H,6-7H2,1H3

SMILES: CSc1ccccc1CCC(=O)c1cc(cc(c1)F)F