CAS 898780-63-7
:3-(2-methylsulfanylphenyl)-1-(3,4,5-trifluorophenyl)propan-1-one
Description:
3-(2-Methylsulfanylphenyl)-1-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898780-63-7, is an organic compound characterized by its complex structure featuring both a ketone functional group and aromatic rings. The presence of the methylsulfanyl group indicates that it has a sulfur atom bonded to a methyl group, which can influence its reactivity and solubility. The trifluorophenyl group introduces significant electronegativity due to the fluorine atoms, potentially affecting the compound's electronic properties and interactions. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of multiple functional groups may contribute to its chemical reactivity, allowing for various synthetic modifications. Overall, this compound exemplifies the complexity and diversity of organic molecules, with potential implications in various fields, including drug discovery and materials science.
Formula:C16H13F3OS
InChI:InChI=1/C16H13F3OS/c1-21-15-5-3-2-4-10(15)6-7-14(20)11-8-12(17)16(19)13(18)9-11/h2-5,8-9H,6-7H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.