CAS 898780-64-8
:1-(2,4-dimethylphenyl)-3-(3,5-dimethylphenyl)propan-1-one
Description:
1-(2,4-Dimethylphenyl)-3-(3,5-dimethylphenyl)propan-1-one, with the CAS number 898780-64-8, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two aromatic groups, specifically 2,4-dimethylphenyl and 3,5-dimethylphenyl, which contribute to its unique chemical properties. This compound is characterized by its relatively high molecular weight and lipophilicity due to the presence of multiple methyl groups on the phenyl rings, which can influence its solubility in organic solvents. It may exhibit interesting photochemical properties, making it of interest in various applications, including organic synthesis and materials science. Additionally, the presence of multiple substituents can affect its reactivity and stability, potentially leading to diverse chemical behaviors. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C19H22O
InChI:InChI=1/C19H22O/c1-13-5-7-18(16(4)10-13)19(20)8-6-17-11-14(2)9-15(3)12-17/h5,7,9-12H,6,8H2,1-4H3
SMILES:Cc1ccc(c(C)c1)C(=O)CCc1cc(C)cc(C)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.