CAS 898780-65-9

1-(2,6-dichlorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:

1-(2,6-Dichlorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898780-65-9, is an organic compound characterized by its complex structure featuring a propanone backbone. This substance contains a dichlorophenyl group and a methylsulfanylphenyl group, which contribute to its chemical properties and potential biological activity. The presence of chlorine atoms in the dichlorophenyl moiety enhances its lipophilicity and may influence its reactivity and interaction with biological targets. The methylsulfanyl group introduces a sulfur atom, which can participate in various chemical reactions and may affect the compound's solubility and stability. This compound is of interest in medicinal chemistry and may exhibit pharmacological properties, although specific biological activities would require further investigation. As with many organic compounds, its handling should be approached with caution, considering potential toxicity and environmental impact. Proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₁₆H₁₄Cl₂OS

InChI: InChI=1/C16H14Cl2OS/c1-20-15-8-3-2-5-11(15)9-10-14(19)16-12(17)6-4-7-13(16)18/h2-8H,9-10H2,1H3

SMILES: CSc1ccccc1CCC(=O)c1c(cccc1Cl)Cl