CAS 898780-67-1

1-Cyclopropyl-3-[2-(methylthio)phenyl]-1-propanone

Description:

1-Cyclopropyl-3-[2-(methylthio)phenyl]-1-propanone, identified by its CAS number 898780-67-1, is an organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring, contributing to its strain and reactivity. The compound also features a ketone functional group, indicated by the presence of the carbonyl (C=O) moiety, which plays a significant role in its chemical reactivity and properties. The methylthio group (-S-CH3) attached to a phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit interesting properties such as potential reactivity in nucleophilic addition reactions due to the electrophilic nature of the carbonyl carbon. Additionally, the presence of the cyclopropyl and methylthio substituents may impart unique steric and electronic effects, making it a subject of interest in synthetic organic chemistry and medicinal chemistry. Its specific applications and biological activities would depend on further studies and evaluations.

Formula: C₁₃H₁₆OS

InChI: InChI=1S/C13H16OS/c1-15-13-5-3-2-4-11(13)8-9-12(14)10-6-7-10/h2-5,10H,6-9H2,1H3

InChI key: InChIKey=HBPYGMFHWTUKHC-UHFFFAOYSA-N

SMILES: C(CC(=O)C1CC1)C2=C(SC)C=CC=C2

Synonyms:

• 1-Cyclopropyl-3-[2-(methylthio)phenyl]-1-propanone
• 1-Propanone, 1-cyclopropyl-3-[2-(methylthio)phenyl]-

cyclopropyl 2-(2-thiomethylphenyl)ethyl ketone

CAS: 898780-67-1

Formula: C₁₃H₁₆OS

Purity: 97.0%

Molecular weight: 220.33

Ref: 10-F205984