CAS 898780-68-2

1-(2,6-dimethylphenyl)-3-(3,5-dimethylphenyl)propan-1-one

Description:

1-(2,6-Dimethylphenyl)-3-(3,5-dimethylphenyl)propan-1-one, also known by its CAS number 898780-68-2, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two aromatic substituents, specifically dimethylphenyl groups, which contribute to its unique chemical properties. The presence of multiple methyl groups on the phenyl rings enhances its hydrophobic character and can influence its reactivity and solubility in organic solvents. Typically, compounds of this nature are characterized by their stability under standard conditions, but they may undergo reactions such as oxidation or reduction depending on the environment. Additionally, due to its structural features, it may exhibit interesting biological activities, making it of interest in various fields, including pharmaceuticals and materials science. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.

Formula: C₁₉H₂₂O

InChI: InChI=1/C19H22O/c1-13-10-14(2)12-17(11-13)8-9-18(20)19-15(3)6-5-7-16(19)4/h5-7,10-12H,8-9H2,1-4H3

SMILES: Cc1cc(C)cc(CCC(=O)c2c(C)cccc2C)c1