CAS 898780-70-6

1-Propanone, 1-(3,4-dimethylphenyl)-3-(3,5-dimethylphenyl)-

Description:

1-Propanone, 1-(3,4-dimethylphenyl)-3-(3,5-dimethylphenyl)-, also known by its CAS number 898780-70-6, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two substituted aromatic rings, specifically 3,4-dimethylphenyl and 3,5-dimethylphenyl groups. This compound is characterized by its relatively high molecular weight and complex structure, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinctive odor, common to many ketones. The presence of multiple methyl groups on the phenyl rings enhances its hydrophobic character, influencing its solubility in organic solvents while rendering it less soluble in water. The compound may exhibit interesting reactivity due to the electron-donating effects of the methyl substituents, potentially participating in various chemical reactions such as electrophilic aromatic substitution. Its applications may span across fields such as organic synthesis, materials science, and potentially in pharmaceuticals, although specific uses would depend on further research and development.

Formula: C₁₉H₂₂O

InChI: InChI=1S/C19H22O/c1-13-9-14(2)11-17(10-13)6-8-19(20)18-7-5-15(3)16(4)12-18/h5,7,9-12H,6,8H2,1-4H3

InChI key: InChIKey=TYEIEKIQBDZCEZ-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC(C)=C(C)C=C1)C2=CC(C)=CC(C)=C2

Synonyms:

• 1-(3,4-Dimethylphenyl)-3-(3,5-dimethylphenyl)-1-propanone
• 3′,4′-Dimethyl-3-(3,5-dimethylphenyl)propiophenone
• 1-Propanone, 1-(3,4-dimethylphenyl)-3-(3,5-dimethylphenyl)-