CAS 898780-72-8
:1,3-Bis(3,5-dimethylphenyl)-1-propanone
Description:
1,3-Bis(3,5-dimethylphenyl)-1-propanone, also known as bisacylphosphine oxide, is an organic compound characterized by its structure, which features two 3,5-dimethylphenyl groups attached to a central propanone moiety. This compound is typically used as a photoinitiator in polymerization processes, particularly in UV-curable coatings and inks. It exhibits high reactivity under UV light, facilitating the initiation of free radical polymerization. The presence of the bulky dimethylphenyl groups enhances its stability and solubility in various organic solvents. Additionally, it has a relatively high molecular weight and a specific melting point range, which can influence its application in industrial settings. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose risks such as skin irritation or respiratory issues upon exposure. Overall, 1,3-Bis(3,5-dimethylphenyl)-1-propanone is valued for its efficiency in initiating polymerization reactions, making it a crucial component in the production of advanced materials.
Formula:C19H22O
InChI:InChI=1S/C19H22O/c1-13-7-14(2)10-17(9-13)5-6-19(20)18-11-15(3)8-16(4)12-18/h7-12H,5-6H2,1-4H3
InChI key:InChIKey=LSBCDZSCLFHXLC-UHFFFAOYSA-N
SMILES:C(CCC1=CC(C)=CC(C)=C1)(=O)C2=CC(C)=CC(C)=C2
Synonyms:- 1-Propanone, 1,3-bis(3,5-dimethylphenyl)-
- 3′,5′-Dimethyl-3-(3,5-dimethylphenyl)propiophenone
- 1,3-Bis(3,5-dimethylphenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.