CAS 898780-73-9
:1-cyclohexyl-3-(2-methylsulfanylphenyl)propan-1-one
Description:
1-Cyclohexyl-3-(2-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898780-73-9, is an organic compound characterized by its ketone functional group and a complex structure that includes a cyclohexyl group and a phenyl ring substituted with a methylthio group. This compound typically exhibits a relatively high molecular weight and is likely to be a solid at room temperature, given the presence of bulky groups that can influence its physical state. It may possess moderate solubility in organic solvents due to its hydrophobic characteristics, while its reactivity can be attributed to the ketone group, which can participate in various chemical reactions such as nucleophilic addition. The presence of the methylthio group may also impart unique electronic properties, potentially affecting its reactivity and interactions with other molecules. Overall, this compound may find applications in organic synthesis, medicinal chemistry, or as an intermediate in the production of other chemical entities.
Formula:C16H22OS
InChI:InChI=1/C16H22OS/c1-18-16-10-6-5-9-14(16)11-12-15(17)13-7-3-2-4-8-13/h5-6,9-10,13H,2-4,7-8,11-12H2,1H3
SMILES:CSc1ccccc1CCC(=O)C1CCCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.