CAS 898780-76-2

1-(4-chloro-3-fluoro-phenyl)-3-(3,5-dimethylphenyl)propan-1-one

Description:

1-(4-chloro-3-fluoro-phenyl)-3-(3,5-dimethylphenyl)propan-1-one, identified by its CAS number 898780-76-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 4-chloro-3-fluorophenyl group and a 3,5-dimethylphenyl group. The presence of chlorine and fluorine atoms in the phenyl ring contributes to its unique electronic properties, potentially influencing its reactivity and interactions in chemical processes. The dimethyl substitution on the second phenyl ring enhances steric hindrance, which may affect the compound's physical properties, such as solubility and boiling point. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other complex molecules. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1/C17H16ClFO/c1-11-7-12(2)9-13(8-11)3-6-17(20)14-4-5-15(18)16(19)10-14/h4-5,7-10H,3,6H2,1-2H3

SMILES: Cc1cc(C)cc(CCC(=O)c2ccc(c(c2)F)Cl)c1

4′-chloro-3-(3,5-dimethylphenyl)-3′-fluoropropiophenone

CAS: 898780-76-2

Formula: C₁₇H₁₆ClFO

Purity: 97.0%

Molecular weight: 290.76

Ref: 10-F206652