CAS 898780-77-3
:1-Propanone, 1-(3-methylphenyl)-3-[4-(methylthio)phenyl]-
Description:
1-Propanone, 1-(3-methylphenyl)-3-[4-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 3-methylphenyl group and a 4-(methylthio)phenyl group. The presence of the methylthio group introduces sulfur into the molecular structure, which can influence the compound's reactivity and properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic components, which can affect their solubility in various solvents. Additionally, the presence of multiple functional groups may impart unique chemical reactivity, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications. The compound's molecular weight, boiling point, and melting point would be determined by its specific structure and substituents, influencing its behavior in different chemical environments. Overall, this compound exemplifies the complexity and diversity found in organic chemistry, particularly in the realm of substituted ketones.
Formula:C17H18OS
InChI:InChI=1S/C17H18OS/c1-13-4-3-5-15(12-13)17(18)11-8-14-6-9-16(19-2)10-7-14/h3-7,9-10,12H,8,11H2,1-2H3
InChI key:InChIKey=HZSMEWFOSVEYHX-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(SC)C=C1)(=O)C2=CC(C)=CC=C2
Synonyms:- 1-Propanone, 1-(3-methylphenyl)-3-[4-(methylthio)phenyl]-
- 1-(3-Methylphenyl)-3-[4-(methylsulfanyl)phenyl]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.