CAS 898780-80-8

1-(2-chlorophenyl)-3-(3,5-dimethylphenyl)propan-1-one

Description:

1-(2-Chlorophenyl)-3-(3,5-dimethylphenyl)propan-1-one, with the CAS number 898780-80-8, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with a 2-chlorophenyl group and a 3,5-dimethylphenyl group, contributing to its unique chemical properties. This compound is characterized by its relatively high molecular weight and specific functional groups that influence its reactivity and solubility. The presence of the chlorophenyl group can enhance its lipophilicity, potentially affecting its biological activity and interactions with other molecules. Additionally, the dimethyl substitutions on the phenyl ring may influence steric hindrance and electronic properties, impacting its reactivity in various chemical reactions. As a ketone, it may participate in nucleophilic addition reactions and can be involved in various synthetic pathways in organic chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.

Formula: C₁₇H₁₇ClO

InChI: InChI=1/C17H17ClO/c1-12-9-13(2)11-14(10-12)7-8-17(19)15-5-3-4-6-16(15)18/h3-6,9-11H,7-8H2,1-2H3

InChI key: InChIKey=AQFSCTULYIPNPS-UHFFFAOYSA-N

SMILES: Cc1cc(C)cc(CCC(=O)c2ccccc2Cl)c1