CAS 898780-82-0

1-Propanone, 3-(3,5-dimethylphenyl)-1-(2-fluorophenyl)-

Description:

1-Propanone, 3-(3,5-dimethylphenyl)-1-(2-fluorophenyl)-, also known by its CAS number 898780-82-0, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3,5-dimethylphenyl group and a 2-fluorophenyl group. The presence of the fluorine atom introduces unique electronic properties, potentially enhancing the compound's reactivity and influencing its interactions in various chemical environments. The dimethyl groups on the phenyl ring can affect steric hindrance and solubility, making the compound of interest in fields such as medicinal chemistry and materials science. Its molecular structure suggests potential applications in organic synthesis and as a building block for more complex molecules. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would be influenced by the substituents and the overall molecular architecture, which are critical for understanding its behavior in different chemical contexts.

Formula: C₁₇H₁₇FO

InChI: InChI=1S/C17H17FO/c1-12-9-13(2)11-14(10-12)7-8-17(19)15-5-3-4-6-16(15)18/h3-6,9-11H,7-8H2,1-2H3

InChI key: InChIKey=FVBNTGNICIEMQO-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=CC(C)=C1)(=O)C2=C(F)C=CC=C2

Synonyms:

• 3-(3,5-Dimethylphenyl)-2′-fluoropropiophenone
• 1-Propanone, 3-(3,5-dimethylphenyl)-1-(2-fluorophenyl)-
• 3-(3,5-Dimethylphenyl)-1-(2-fluorophenyl)-1-propanone

3-(3,5-dimethylphenyl)-2′-fluoropropiophenone

CAS: 898780-82-0

Formula: C₁₇H₁₇FO

Purity: 97.0%

Molecular weight: 256.32

Ref: 10-F206655