CAS 898780-83-1

1-Propanone, 1-(3-methoxyphenyl)-3-[4-(methylthio)phenyl]-

Description:

1-Propanone, 1-(3-methoxyphenyl)-3-[4-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with substituents that include a methoxyphenyl group and a methylthio-substituted phenyl group, contributing to its complexity and potential reactivity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its electronic properties, while the methylthio group can affect its reactivity and interactions with other molecules. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit interesting biological activities, although specific data on its pharmacological properties would require further investigation. Overall, this compound exemplifies the diversity of organic molecules and their potential utility in various chemical applications.

Formula: C₁₇H₁₈O₂S

InChI: InChI=1/C17H18O2S/c1-19-15-5-3-4-14(12-15)17(18)11-8-13-6-9-16(20-2)10-7-13/h3-7,9-10,12H,8,11H2,1-2H3

InChI key: InChIKey=IDQLQYGRTSLQKX-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(SC)C=C1)(=O)C2=CC(OC)=CC=C2

Synonyms:

• 1-Propanone, 1-(3-methoxyphenyl)-3-[4-(methylthio)phenyl]-
• 1-(3-Methoxyphenyl)-3-[4-(methylsulfanyl)phenyl]-1-propanone

3′-methoxy-3-(4-thiomethylphenyl)propiophenone

CAS: 898780-83-1

Formula: C₁₇H₁₈O₂S

Purity: 97.0%

Molecular weight: 286.39

Ref: 10-F205993