CAS 898780-85-3

1-Propanone, 1-(4-methoxyphenyl)-3-[4-(methylthio)phenyl]-

Description:

1-Propanone, 1-(4-methoxyphenyl)-3-[4-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a para-methoxyphenyl group and a para-methylthio phenyl group. The presence of the methoxy group enhances its electron-donating properties, potentially influencing its reactivity and solubility in organic solvents. The methylthio group introduces a sulfur atom, which can affect the compound's electronic properties and steric hindrance. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic rings, making it soluble in organic solvents but less so in water. Its unique structure may confer specific biological activities, making it of interest in pharmaceutical research. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic rings, which may participate in various chemical reactions, including electrophilic aromatic substitution. Overall, this compound represents a complex interplay of functional groups that can be explored for various applications in organic synthesis and medicinal chemistry.

Formula: C₁₇H₁₈O₂S

InChI: InChI=1S/C17H18O2S/c1-19-15-8-6-14(7-9-15)17(18)12-5-13-3-10-16(20-2)11-4-13/h3-4,6-11H,5,12H2,1-2H3

InChI key: InChIKey=GQKJUSTUEVBXTA-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(SC)C=C1)(=O)C2=CC=C(OC)C=C2

Synonyms:

• 1-(4-Methoxyphenyl)-3-[4-(methylsulfanyl)phenyl]-1-propanone
• 1-Propanone, 1-(4-methoxyphenyl)-3-[4-(methylthio)phenyl]-

4′-methoxy-3-(4-thiomethylphenyl)propiophenone

CAS: 898780-85-3

Formula: C₁₇H₁₈O₂S

Purity: 97.0%

Molecular weight: 286.39

Ref: 10-F205994