CAS 898780-88-6

1-Propanone, 3-(3,5-dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(3,5-dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is indicated by the "propanone" part of its name. This compound features a propanone backbone with two distinct aromatic substituents: a 3,5-dimethylphenyl group and a 4-trifluoromethylphenyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and interaction with biological systems. The dimethyl groups on the phenyl ring contribute to steric hindrance, potentially affecting the compound's physical properties, such as boiling and melting points, as well as its solubility in various solvents. Additionally, the presence of fluorine atoms often imparts unique electronic properties, making such compounds of interest in medicinal chemistry and materials science. Overall, this compound's structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research into its properties and behavior.

Formula: C₁₈H₁₇F₃O

InChI: InChI=1S/C18H17F3O/c1-12-9-13(2)11-14(10-12)3-8-17(22)15-4-6-16(7-5-15)18(19,20)21/h4-7,9-11H,3,8H2,1-2H3

InChI key: InChIKey=AENXQQRJHDIWKO-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=CC(C)=C1)(=O)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 3-(3,5-Dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]-1-propanone
• 1-Propanone, 3-(3,5-dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]-
• 3-(3,5-Dimethylphenyl)-4′-trifluoromethyl-propiophenone

3-(3,5-dimethylphenyl)-4′-trifluoromethylpropiophenone

CAS: 898780-88-6

Formula: C₁₈H₁₇F₃O

Purity: 97.0%

Molecular weight: 306.328

Ref: 10-F206658