CAS 898780-96-6

1-(4-chloro-2-fluoro-phenyl)-3-(3,5-dimethylphenyl)propan-1-one

Description:

1-(4-chloro-2-fluoro-phenyl)-3-(3,5-dimethylphenyl)propan-1-one, with the CAS number 898780-96-6, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a chloro and a fluoro group on one phenyl ring, and a dimethyl-substituted phenyl group on the other. This compound is typically classified as a ketone due to the presence of the carbonyl group (C=O) in its structure. The presence of halogen atoms (chlorine and fluorine) suggests potential reactivity and influences its physical properties, such as solubility and boiling point. Additionally, the dimethyl substitution can affect the steric hindrance and electronic properties of the molecule, potentially impacting its reactivity and interactions with biological systems. Such compounds may be of interest in medicinal chemistry and material science due to their unique structural features and potential applications in drug development or as intermediates in organic synthesis.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1/C17H16ClFO/c1-11-7-12(2)9-13(8-11)3-6-17(20)15-5-4-14(18)10-16(15)19/h4-5,7-10H,3,6H2,1-2H3

SMILES: Cc1cc(C)cc(CCC(=O)c2ccc(cc2F)Cl)c1

4′-chloro-3-(3,5-dimethylphenyl)-2′-fluoropropiophenone

CAS: 898780-96-6

Formula: C₁₇H₁₆ClFO

Purity: 97.0%

Molecular weight: 290.76

Ref: 10-F206662