CAS 898780-99-9
:1-[2-(Methylthio)phenyl]-3-[4-(methylthio)phenyl]-1-propanone
Description:
1-[2-(Methylthio)phenyl]-3-[4-(methylthio)phenyl]-1-propanone, identified by its CAS number 898780-99-9, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone substituted with two methylthio groups attached to phenyl rings, which contribute to its unique chemical properties. The presence of the methylthio groups enhances its lipophilicity and may influence its reactivity and interaction with biological systems. Typically, compounds of this nature can exhibit interesting photochemical properties, making them relevant in fields such as organic synthesis and materials science. Additionally, the structural arrangement of the methylthio groups can affect the compound's electronic properties, potentially leading to applications in organic electronics or as intermediates in the synthesis of more complex molecules. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity or environmental impact. Proper laboratory practices should be followed when working with this substance.
Formula:C17H18OS2
InChI:InChI=1S/C17H18OS2/c1-19-14-10-7-13(8-11-14)9-12-16(18)15-5-3-4-6-17(15)20-2/h3-8,10-11H,9,12H2,1-2H3
InChI key:InChIKey=JFIXLMJNUNSTLK-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(SC)C=C1)(=O)C2=C(SC)C=CC=C2
Synonyms:- 1-[2-(Methylthio)phenyl]-3-[4-(methylthio)phenyl]-1-propanone
- 1-Propanone, 1-[2-(methylthio)phenyl]-3-[4-(methylthio)phenyl]-
- 1-[2-(Methylsulfanyl)phenyl]-3-[4-(methylsulfanyl)phenyl]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.